Difference between revisions of "RXN-7811"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7811 RXN-7811] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7811 RXN-7811] ==
−
* smiles:
+
* direction:
−
** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N
+
** [http://enzyme.expasy.org/EC/2.5.1 EC-2.5.1]
−
* common name:
+
−
** XLXG xyloglucan oligosaccharide
+
−
* molecular weight:
+
−
** 1225.073   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12399]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN]][c] '''+''' 1 [[CPD-4211]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CPD-7109]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 phlorisovalerophenone[c] '''+''' 1 dimethylallyl diphosphate[c] '''=>''' 1 diphosphate[c] '''+''' 1 4-prenylphlorisovalerophenone[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008265001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5132]], humulone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5132 PWY-5132]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940192 52940192]
+
{{#set: ec number=EC-2.5.1}}
−
{{#set: smiles=C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)}}
+
{{#set: gene associated=CHC_T00008265001_1}}
−
{{#set: inchi key=InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N}}
+
{{#set: in pathway=PWY-5132}}
−
{{#set: common name=XLXG xyloglucan oligosaccharide}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=1225.073    }}
+
{{#set: reconstruction source=orthology-ectocarpus_siliculosus}}
−
{{#set: consumed by=RXN-12399}}
+
{{#set: reconstruction tool=pantograph}}

Revision as of 16:33, 23 May 2018

Reaction RXN-7811

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5132, humulone biosynthesis: PWY-5132
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-7811&oldid=17476"