Difference between revisions of "HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == * smiles: ** C(OP([O-])([O-])=O)C([N+])C([O-])=O * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN] == * direction: ** LEFT-TO...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.1.3.4 EC-4.1.3.4] |
− | * | + | |
− | ** 3- | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[3-HYDROXY-3-METHYL-GLUTARYL-COA]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[3-KETOBUTYRATE]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 (S)-3-hydroxy-3-methylglutaryl-CoA[c] '''=>''' 1 acetyl-CoA[c] '''+''' 1 acetoacetate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00004158001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | == Pathways == | ||
+ | * [[PWY66-367]], ketogenesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-367 PWY66-367] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[LEU-DEG2-PWY]], L-leucine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=LEU-DEG2-PWY LEU-DEG2-PWY] | ||
+ | ** '''3''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-5074]], mevalonate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5074 PWY-5074] | ||
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24404 24404] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01360 R01360] |
− | + | * UNIPROT: | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/P35914 P35914] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P35915 P35915] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q8L7K2 Q8L7K2] |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | * | + | {{#set: ec number=EC-4.1.3.4}} |
− | ** [http://www. | + | {{#set: gene associated=CHC_T00004158001_1}} |
− | + | {{#set: in pathway=PWY66-367|LEU-DEG2-PWY|PWY-5074}} | |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:35, 23 May 2018
Contents
Reaction HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 3-HYDROXY-3-METHYL-GLUTARYL-COA[c] => 1 ACETYL-COA[c] + 1 3-KETOBUTYRATE[c]
- With common name(s):
- 1 (S)-3-hydroxy-3-methylglutaryl-CoA[c] => 1 acetyl-CoA[c] + 1 acetoacetate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00004158001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
Pathways
- PWY66-367, ketogenesis: PWY66-367
- 4 reactions found over 5 reactions in the full pathway
- LEU-DEG2-PWY, L-leucine degradation I: LEU-DEG2-PWY
- 3 reactions found over 6 reactions in the full pathway
- PWY-5074, mevalonate degradation: PWY-5074
- 1 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-arabidopsis_thaliana
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-arabidopsis_thaliana
External links