Difference between revisions of "D-HEXOSE-6-PHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14779 CPD-14779] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)=O) * inchi key: ** InChIKey=PHOQVHQ...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-HEXOSE-6-PHOSPHATE D-HEXOSE-6-PHOSPHATE] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-HEXOSE-6-PHOSPHATE D-HEXOSE-6-PHOSPHATE] == |
* smiles: | * smiles: | ||
− | ** C(O)C1(OC(C(C( | + | ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L |
* common name: | * common name: | ||
− | ** D- | + | ** D-hexose 6-phosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[HEXOKINASE-RXN]] | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4459709 4459709] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.3658466.html 3658466] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61567 61567] |
− | * | + | * LIGAND-CPD: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02965 C02965] |
− | {{#set: smiles=C(O)C1(OC(C(C( | + | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L}} |
− | {{#set: common name=D- | + | {{#set: common name=D-hexose 6-phosphate}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=258.121 }} |
− | {{#set: | + | {{#set: reversible reaction associated=HEXOKINASE-RXN}} |
− | + |
Revision as of 16:36, 23 May 2018
Contents
Metabolite D-HEXOSE-6-PHOSPHATE
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)
- inchi key:
- InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L
- common name:
- D-hexose 6-phosphate
- molecular weight:
- 258.121
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.