Difference between revisions of "CHC T00007021001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9...")
 
(Created page with "Category:Gene == Gene CHC_T00007021001_1 == * Synonym(s): == Reactions associated == * Reaction: 3.1.3.16-RXN ** Source: orthology-galdieria.sulphuraria == Pathwa...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] ==
+
== Gene CHC_T00007021001_1 ==
−
* smiles:
+
−
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
−
* common name:
+
−
** 3,8-divinyl protochlorophyllide a
+
−
* molecular weight:
+
−
** 608.935   
+
 
* Synonym(s):
 
* Synonym(s):
−
** divinylprotochlorophyllide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-5285]]
+
* Reaction: [[3.1.3.16-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-galdieria.sulphuraria]]
−
* [[RXN-13191]]
+
== Pathways associated ==
−
* [[RXN-5284]]
+
−
== Reaction(s) of unknown directionality ==
+
−
* [[RXN1F-72]]
+
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=3.1.3.16-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54743931 54743931]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58632 58632]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C11831 C11831]
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=3,8-divinyl protochlorophyllide a}}
+
−
{{#set: molecular weight=608.935    }}
+
−
{{#set: common name=divinylprotochlorophyllide}}
+
−
{{#set: consumed by=RXN-5285}}
+
−
{{#set: produced by=RXN-13191|RXN-5284}}
+
−
{{#set: consumed or produced by=RXN1F-72}}
+

Latest revision as of 17:37, 23 May 2018

Gene CHC_T00007021001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00007021001_1&oldid=17665"