Difference between revisions of "CPD-18841"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17203 RXN-17203] == * direction: ** REVERSIBLE * common name: ** Glycolipid sulfotransferase *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18841 CPD-18841] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17203 RXN-17203] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18841 CPD-18841] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-]C5=C(N67)8)))))9))))
 
* common name:
 
* common name:
−
** Glycolipid sulfotransferase
+
** 8-ethyl-12-methyl-3-vinyl-bacteriochlorophyllide d
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.8.2.11 EC-2.8.2.11]
+
** 554.93   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3V[E,M]-bacteriochlorophyllide d
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[1-Alkyl-2-acyl-3D-galactosyl-sn-glycerol]][c] '''+''' 1 [[PAPS]][c] '''<=>''' 1 [[Seminolipids]][c] '''+''' 1 [[3-5-ADP]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN-17429]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a 1-O-alkyl-2-O-acyl-3-O-&beta;-D-galactosyl-sn-glycerol[c] '''+''' 1 3'-phosphoadenylyl-sulfate[c] '''<=>''' 1 a seminolipid[c] '''+''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00009336001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[CHC_T00008762001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[CHC_T00008551001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-]C5=C(N67)8)))))9))))}}
−
{{#set: common name=Glycolipid sulfotransferase}}
+
{{#set: common name=8-ethyl-12-methyl-3-vinyl-bacteriochlorophyllide d}}
−
{{#set: ec number=EC-2.8.2.11}}
+
{{#set: molecular weight=554.93    }}
−
{{#set: gene associated=CHC_T00009336001|CHC_T00008762001|CHC_T00008551001}}
+
{{#set: common name=3V[E,M]-bacteriochlorophyllide d}}
−
{{#set: in pathway=}}
+
{{#set: produced by=RXN-17429}}
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=original_genome}}
+

Revision as of 17:39, 23 May 2018

Metabolite CPD-18841

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-]C5=C(N67)8)))))9))))
  • common name:
    • 8-ethyl-12-methyl-3-vinyl-bacteriochlorophyllide d
  • molecular weight:
    • 554.93
  • Synonym(s):
    • 3V[E,M]-bacteriochlorophyllide d

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-]C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.


"3V[E,M]-bacteriochlorophyllide d" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-18841&oldid=17740"