Difference between revisions of "CHC T00009411001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=RGH...") |
(Created page with "Category:Gene == Gene CHC_T00009411001 == * left end position: ** 43484 * transcription direction: ** NEGATIVE * right end position: ** 46564 * centisome position: ** 22.0...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene CHC_T00009411001 == |
| − | * | + | * left end position: |
| − | ** | + | ** 43484 |
| − | * | + | * transcription direction: |
| − | ** | + | ** NEGATIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 46564 |
| − | * | + | * centisome position: |
| − | ** | + | ** 22.060219 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
| − | + | ** Source: [[annotation-original_genome]] | |
| − | * [[ | + | *** Assignment: automated-name-match |
| − | * | + | == Pathways associated == |
| − | == | + | |
== External links == | == External links == | ||
| − | + | {{#set: left end position=43484}} | |
| − | + | {{#set: transcription direction=NEGATIVE}} | |
| − | + | {{#set: right end position=46564}} | |
| − | + | {{#set: centisome position=22.060219 }} | |
| − | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 16:39, 23 May 2018
Gene CHC_T00009411001
- left end position:
- 43484
- transcription direction:
- NEGATIVE
- right end position:
- 46564
- centisome position:
- 22.060219
- Synonym(s):
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
