Difference between revisions of "CHC T00008097001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] == * smiles: ** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O) * inchi key: ** InChIKe...")
 
(Created page with "Category:Gene == Gene CHC_T00008097001_1 == * Synonym(s): == Reactions associated == * Reaction: AICARSYN-RXN ** Source: orthology-galdieria.sulphuraria ** Source...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] ==
+
== Gene CHC_T00008097001_1 ==
−
* smiles:
+
−
** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)
+
−
* inchi key:
+
−
** InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M
+
−
* common name:
+
−
** sinapate
+
−
* molecular weight:
+
−
** 223.205   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3,5-dimethoxy-4-hydroxycinnamate
 
−
** sinapinate
 
−
** sinapinic acid
 
−
** sinapic acid
 
−
** 3,5-dimethoxy-4-hydroxycinnamic acid
 
−
** 4-hydroxy-3,5-dimethoxycinnamate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10919]]
+
* Reaction: [[AICARSYN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-galdieria.sulphuraria]]
−
* [[RXN-8014]]
+
** Source: [[orthology-ectocarpus_siliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[AMPSYN-RXN]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7219]]
 +
* [[PWY-6123]]
 +
* [[PWY-6124]]
 +
* [[PWY-7234]]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: reaction associated=AICARSYN-RXN|AMPSYN-RXN}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=59261 59261]
+
{{#set: pathway associated=PWY-7219|PWY-6123|PWY-6124|PWY-7234}}
−
* CAS : 530-59-6
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54710960 54710960]
+
−
* HMDB : HMDB32616
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00482 C00482]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4573878.html 4573878]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30023 30023]
+
−
{{#set: smiles=COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M}}
+
−
{{#set: common name=sinapate}}
+
−
{{#set: molecular weight=223.205    }}
+
−
{{#set: common name=3,5-dimethoxy-4-hydroxycinnamate|sinapinate|sinapinic acid|sinapic acid|3,5-dimethoxy-4-hydroxycinnamic acid|4-hydroxy-3,5-dimethoxycinnamate}}
+
−
{{#set: consumed by=RXN-10919}}
+
−
{{#set: produced by=RXN-8014}}
+

Revision as of 16:39, 23 May 2018

Gene CHC_T00008097001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008097001_1&oldid=17773"