Difference between revisions of "RXN-13308"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTETHEINE-P PANTETHEINE-P] == * smiles: ** CC(C(O)C(=O)NCCC(NCCS)=O)(C)COP([O-])(=O)[O-] * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13308 RXN-13308] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13308 RXN-13308] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.1.93 EC-1.3.1.93] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[CPD-14282]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-10280]][c] '''+''' 1 [[NADP]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 trans-lignocer-2-enoyl-CoA[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 lignoceroyl-CoA[c] '''+''' 1 NADP+[c] |
− | == | + | |
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036] | ||
+ | ** '''8''' reactions found over '''16''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[gap-filling]] | ||
+ | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | *** Tool: [[meneco]] | ||
+ | **** Comment: [[added for gapfilling]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-1.3.1.93}} | |
− | + | {{#set: in pathway=PWY-7036}} | |
− | + | {{#set: reconstruction category=gap-filling}} | |
− | + | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} | |
− | + | {{#set: reconstruction tool=meneco}} | |
− | + | {{#set: reconstruction comment=added for gapfilling}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 15:50, 23 May 2018
Contents
Reaction RXN-13308
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 trans-lignocer-2-enoyl-CoA[c] + 1 NADPH[c] + 1 H+[c] => 1 lignoceroyl-CoA[c] + 1 NADP+[c]
Genes associated with this reaction
Pathways
- PWY-7036, very long chain fatty acid biosynthesis II: PWY-7036
- 8 reactions found over 16 reactions in the full pathway
Reconstruction information
- Category: gap-filling
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
- Tool: meneco
- Comment: added for gapfilling
- Tool: meneco
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium