Difference between revisions of "RXN-13308"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTETHEINE-P PANTETHEINE-P] == * smiles: ** CC(C(O)C(=O)NCCC(NCCS)=O)(C)COP([O-])(=O)[O-] * in...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13308 RXN-13308] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTETHEINE-P PANTETHEINE-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13308 RXN-13308] ==
−
* smiles:
+
* direction:
−
** CC(C(O)C(=O)NCCC(NCCS)=O)(C)COP([O-])(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=JDMUPRLRUUMCTL-VIFPVBQESA-L
+
** [http://enzyme.expasy.org/EC/1.3.1.93 EC-1.3.1.93]
−
* common name:
+
−
** 4'-phosphopantetheine
+
−
* molecular weight:
+
−
** 356.33   
+
 
* Synonym(s):
 
* Synonym(s):
−
** phosphopantotheine
 
−
** pantetheine 4'-phosphate
 
−
** phosphopantetheine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[PANTEPADENYLYLTRAN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-14282]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-10280]][c] '''+''' 1 [[NADP]][c]
−
* [[3.1.4.14-RXN]]
+
* With common name(s):
−
* [[P-PANTOCYSDECARB-RXN]]
+
** 1 trans-lignocer-2-enoyl-CoA[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 lignoceroyl-CoA[c] '''+''' 1 NADP+[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036]
 +
** '''8''' reactions found over '''16''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
−
* BIGG : pan4p
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.3.1.93}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245905 25245905]
+
{{#set: in pathway=PWY-7036}}
−
* HMDB : HMDB01416
+
{{#set: reconstruction category=gap-filling}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01134 C01134]
+
{{#set: reconstruction tool=meneco}}
−
* CHEBI:
+
{{#set: reconstruction comment=added for gapfilling}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61723 61723]
+
−
* METABOLIGHTS : MTBLC61723
+
−
{{#set: smiles=CC(C(O)C(=O)NCCC(NCCS)=O)(C)COP([O-])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=JDMUPRLRUUMCTL-VIFPVBQESA-L}}
+
−
{{#set: common name=4'-phosphopantetheine}}
+
−
{{#set: molecular weight=356.33    }}
+
−
{{#set: common name=phosphopantotheine|pantetheine 4'-phosphate|phosphopantetheine}}
+
−
{{#set: consumed by=PANTEPADENYLYLTRAN-RXN}}
+
−
{{#set: produced by=3.1.4.14-RXN|P-PANTOCYSDECARB-RXN}}
+

Latest revision as of 14:50, 23 May 2018

Reaction RXN-13308

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 trans-lignocer-2-enoyl-CoA[c] + 1 NADPH[c] + 1 H+[c] => 1 lignoceroyl-CoA[c] + 1 NADP+[c]

Genes associated with this reaction

Pathways

  • PWY-7036, very long chain fatty acid biosynthesis II: PWY-7036
    • 8 reactions found over 16 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-13308&oldid=12259"