Difference between revisions of "RXN-12398"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] == * smiles: ** CSCCC(C([O-])=CO)=O * inchi key: ** InChIKey=CILXJJLQPTUUSS-XQRV...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12398 RXN-12398] == * direction: ** LEFT-TO-RIGHT * common name: ** xyloglucan XXLG oligosaccha...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12398 RXN-12398] ==
−
* smiles:
+
* direction:
−
** CSCCC(C([O-])=CO)=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M
+
 
* common name:
 
* common name:
−
** 1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
+
** xyloglucan XXLG oligosaccharide β-galactosidase
−
* molecular weight:
+
* ec number:
−
** 161.195   
+
** [http://enzyme.expasy.org/EC/3.2.1.23 EC-3.2.1.23]
 
* Synonym(s):
 
* Synonym(s):
−
** 1,2-dihydroxy-3-keto-5-methylthiopentene anion
 
−
** 1,2-dihydroxy-3-keto-5-methylthiopentane
 
−
** 1,2-dihydroxy-3-keto-5-methylthiopentene
 
−
** acireductone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[R147-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-13376]][c] '''=>''' 1 [[D-galactopyranose]][c] '''+''' 1 [[CPD-13375]][c]
−
* [[R83-RXN]]
+
* With common name(s):
−
* [[3.1.3.77-RXN]]
+
** 1 H2O[c] '''+''' 1 XXLG xyloglucan oligosaccharide[c] '''=>''' 1 D-galactopyranose[c] '''+''' 1 XXXG xyloglucan oligosaccharide[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008905001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00008606001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-6807]], xyloglucan degradation II (exoglucanase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6807 PWY-6807]
 +
** '''3''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229177 44229177]
+
{{#set: common name=xyloglucan XXLG oligosaccharide β-galactosidase}}
−
* CHEBI:
+
{{#set: ec number=EC-3.2.1.23}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58795 58795]
+
{{#set: gene associated=CHC_T00008905001_1|CHC_T00008606001_1}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6807}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15606 C15606]
+
{{#set: reconstruction category=orthology}}
−
* HMDB : HMDB12134
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
−
{{#set: smiles=CSCCC(C([O-])=CO)=O}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M}}
+
−
{{#set: common name=1,2-dihydroxy-5-(methylthio)pent-1-en-3-one}}
+
−
{{#set: molecular weight=161.195    }}
+
−
{{#set: common name=1,2-dihydroxy-3-keto-5-methylthiopentene anion|1,2-dihydroxy-3-keto-5-methylthiopentane|1,2-dihydroxy-3-keto-5-methylthiopentene|acireductone}}
+
−
{{#set: consumed by=R147-RXN}}
+
−
{{#set: produced by=R83-RXN|3.1.3.77-RXN}}
+

Latest revision as of 15:51, 23 May 2018

Reaction RXN-12398

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • xyloglucan XXLG oligosaccharide β-galactosidase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 XXLG xyloglucan oligosaccharide[c] => 1 D-galactopyranose[c] + 1 XXXG xyloglucan oligosaccharide[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6807, xyloglucan degradation II (exoglucanase): PWY-6807
    • 3 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-12398&oldid=12319"