Difference between revisions of "CPD-85"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00002741001_1 == * Synonym(s): == Reactions associated == * MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN ** pantograph-galdieria.sulphurari...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] == * smiles: ** CSCCC(C([O-])=CO)=O * inchi key: ** InChIKey=CILXJJLQPTUUSS-XQRV...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] == |
+ | * smiles: | ||
+ | ** CSCCC(C([O-])=CO)=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M | ||
+ | * common name: | ||
+ | ** 1,2-dihydroxy-5-(methylthio)pent-1-en-3-one | ||
+ | * molecular weight: | ||
+ | ** 161.195 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 1,2-dihydroxy-3-keto-5-methylthiopentene anion | ||
+ | ** 1,2-dihydroxy-3-keto-5-methylthiopentane | ||
+ | ** 1,2-dihydroxy-3-keto-5-methylthiopentene | ||
+ | ** acireductone | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[R83-RXN]] | |
− | == | + | * [[3.1.3.77-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229177 44229177] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58795 58795] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15606 C15606] | ||
+ | * HMDB : HMDB12134 | ||
+ | {{#set: smiles=CSCCC(C([O-])=CO)=O}} | ||
+ | {{#set: inchi key=InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M}} | ||
+ | {{#set: common name=1,2-dihydroxy-5-(methylthio)pent-1-en-3-one}} | ||
+ | {{#set: molecular weight=161.195 }} | ||
+ | {{#set: common name=1,2-dihydroxy-3-keto-5-methylthiopentene anion|1,2-dihydroxy-3-keto-5-methylthiopentane|1,2-dihydroxy-3-keto-5-methylthiopentene|acireductone}} | ||
+ | {{#set: produced by=R83-RXN|3.1.3.77-RXN}} |
Revision as of 15:51, 23 May 2018
Contents
Metabolite CPD-85
- smiles:
- CSCCC(C([O-])=CO)=O
- inchi key:
- InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M
- common name:
- 1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
- molecular weight:
- 161.195
- Synonym(s):
- 1,2-dihydroxy-3-keto-5-methylthiopentene anion
- 1,2-dihydroxy-3-keto-5-methylthiopentane
- 1,2-dihydroxy-3-keto-5-methylthiopentene
- acireductone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CSCCC(C([O-])=CO)=O" cannot be used as a page name in this wiki.