Difference between revisions of "CPD-10330"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008413001 == * left end position: ** 186468 * transcription direction: ** POSITIVE * right end position: ** 189446 * centisome position: ** 31...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * smiles: ** C(C1(C(C(C(O1)O)O)O))O * inchi key: ** InChIKey=HMFHBZSHGG...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C1(C(C(C(O1)O)O)O))O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N |
| − | * | + | * common name: |
| − | ** | + | ** α-D-ribofuranose |
| − | * | + | * molecular weight: |
| − | ** | + | ** 150.131 |
* Synonym(s): | * Synonym(s): | ||
| + | ** α D-ribose | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RIBOKIN-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.5575.html 5575] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45506 45506] |
| + | * HMDB : HMDB00283 | ||
| + | {{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}} | ||
| + | {{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N}} | ||
| + | {{#set: common name=α-D-ribofuranose}} | ||
| + | {{#set: molecular weight=150.131 }} | ||
| + | {{#set: common name=α D-ribose}} | ||
| + | {{#set: consumed by=RIBOKIN-RXN}} | ||
Revision as of 14:51, 23 May 2018
Contents
Metabolite CPD-10330
- smiles:
- C(C1(C(C(C(O1)O)O)O))O
- inchi key:
- InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
- common name:
- α-D-ribofuranose
- molecular weight:
- 150.131
- Synonym(s):
- α D-ribose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
