Difference between revisions of "PWY-5913"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-BUTYRATE 4-AMINO-BUTYRATE] == * smiles: ** C(C[N+])CC([O-])=O * inchi key: ** InChIKey=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1118 TAX-11...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-BUTYRATE 4-AMINO-BUTYRATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913] ==
−
* smiles:
+
* taxonomic range:
−
** C(C[N+])CC([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1118 TAX-1118]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1217 TAX-1217]
−
** InChIKey=BTCSSZJGUNDROE-UHFFFAOYSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
 
* common name:
 
* common name:
−
** 4-aminobutanoate
+
** partial TCA cycle (obligate autotrophs)
−
* molecular weight:
+
−
** 103.121   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4-NH2-but
+
** TCA cycle VI (obligate autotrophs)
−
** 4-NH3-but
+
−
** GABA
+
−
** 4-aminobutyric acid
+
−
** γ-aminobutyrate
+
−
** 4-amino-n-butyric acid
+
−
** γ-amino-n-butyric acid
+
−
** gamma-amino-N-butyrate
+
−
** g-amino-n-butyric acid
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''10''' reactions found over '''11''' reactions in the full pathway
−
* [[RXN0-3942]]
+
* [[ACONITATEDEHYDR-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
−
* [[RXN-14209]]
+
*** [[CHC_T00009087001_1]]
 +
*** [[CHC_T00008781001_1]]
 +
*** [[CHC_T00008781001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[ACONITATEHYDR-RXN]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00009087001_1]]
 +
*** [[CHC_T00008781001]]
 +
*** [[CHC_T00008781001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
** 8 associated gene(s):
 +
*** [[CHC_T00010017001]]
 +
*** [[CHC_T00005085001_1]]
 +
*** [[CHC_T00008432001]]
 +
*** [[CHC_T00006498001_1]]
 +
*** [[CHC_T00009477001]]
 +
*** [[CHC_T00003344001_1]]
 +
*** [[CHC_T00009477001_1]]
 +
*** [[CHC_T00010197001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[CITSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00007817001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[FUMHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00008951001_1]]
 +
*** [[CHC_T00008951001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[GLUTDEHYD-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00010235001]]
 +
*** [[CHC_T00010235001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[ISOCITDEH-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009580001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[MALATE-DEH-RXN]]
 +
** 6 associated gene(s):
 +
*** [[CHC_T00008733001]]
 +
*** [[CHC_T00009350001_1]]
 +
*** [[CHC_T00009173001_1]]
 +
*** [[CHC_T00009292001_1]]
 +
*** [[CHC_T00008733001_1]]
 +
*** [[CHC_T00008600001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[PEPCARBOX-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00008437001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[SUCCCOASYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009212001_1]]
 +
*** [[CHC_T00008602001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14970 RXN-14970]
 
== External links  ==
 
== External links  ==
−
* CAS : 56-12-2
+
{{#set: taxonomic range=TAX-1118}}
−
* METABOLIGHTS : MTBLC59888
+
{{#set: taxonomic range=TAX-1217}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1224}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992099 6992099]
+
{{#set: common name=partial TCA cycle (obligate autotrophs)}}
−
* HMDB : HMDB00112
+
{{#set: common name=TCA cycle VI (obligate autotrophs)}}
−
* LIGAND-CPD:
+
{{#set: reaction found=10}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00334 C00334]
+
{{#set: total reaction=11}}
−
* CHEBI:
+
{{#set: completion rate=91.0}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59888 59888]
+
−
* BIGG : 4abut
+
−
{{#set: smiles=C(C[N+])CC([O-])=O}}
+
−
{{#set: inchi key=InChIKey=BTCSSZJGUNDROE-UHFFFAOYSA-N}}
+
−
{{#set: common name=4-aminobutanoate}}
+
−
{{#set: molecular weight=103.121    }}
+
−
{{#set: common name=4-NH2-but|4-NH3-but|GABA|4-aminobutyric acid|γ-aminobutyrate|4-amino-n-butyric acid|γ-amino-n-butyric acid|gamma-amino-N-butyrate|g-amino-n-butyric acid}}
+
−
{{#set: produced by=RXN0-3942}}
+
−
{{#set: consumed or produced by=RXN-14209}}
+

Revision as of 14:51, 23 May 2018

Pathway PWY-5913

  • taxonomic range:
  • common name:
    • partial TCA cycle (obligate autotrophs)
  • Synonym(s):
    • TCA cycle VI (obligate autotrophs)

Reaction(s) found

10 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-5913&oldid=12350"