Difference between revisions of "PWY-5030"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == * smiles: ** C(C([N+])C(=O)[O-])S(=O)(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5030 PWY-5030] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5030 PWY-5030] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** L- | + | ** L-histidine degradation III |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''2''' reactions found over '''6''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[HISTIDINE-AMMONIA-LYASE-RXN]] |
− | * [[RXN- | + | ** 1 associated gene(s): |
+ | *** [[CHC_T00004806001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[METHENYLTHFCYCLOHYDRO-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00008680001_1]] | ||
+ | *** [[CHC_T00008670001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=4.3.1.4-RXN 4.3.1.4-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMATE-FORMIMINOTRANSFERASE-RXN GLUTAMATE-FORMIMINOTRANSFERASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLONEPROPIONASE-RXN IMIDAZOLONEPROPIONASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=UROCANATE-HYDRATASE-RXN UROCANATE-HYDRATASE-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-40674}} | |
− | + | {{#set: common name=L-histidine degradation III}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=33.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name=L- | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:53, 23 May 2018
Pathway PWY-5030
- taxonomic range:
- common name:
- L-histidine degradation III
- Synonym(s):
Reaction(s) found
2 reactions found over 6 reactions in the full pathway
- HISTIDINE-AMMONIA-LYASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- METHENYLTHFCYCLOHYDRO-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated: