Difference between revisions of "PWY0-1545"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * smiles: ** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4)) *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1545 PWY0-1545] == * common name: ** cardiolipin biosynthesis III * Synonym(s): == Reaction(s)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1545 PWY0-1545] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** cardiolipin biosynthesis III |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[PHOSPHAGLYPSYN-RXN]] |
| − | * [ | + | ** 4 associated gene(s): |
| + | *** [[CHC_T00008428001]] | ||
| + | *** [[CHC_T00009507001_1]] | ||
| + | *** [[CHC_T00009507001]] | ||
| + | *** [[CHC_T00008428001_1]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=PGPPHOSPHA-RXN PGPPHOSPHA-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7012 RXN0-7012] | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1545 PWY0-1545] |
| − | {{#set: | + | {{#set: common name=cardiolipin biosynthesis III}} |
| − | {{#set: | + | {{#set: reaction found=1}} |
| − | {{#set: | + | {{#set: total reaction=3}} |
| − | {{#set: | + | {{#set: completion rate=33.0}} |
| − | + | ||
Revision as of 14:54, 23 May 2018
Pathway PWY0-1545
- common name:
- cardiolipin biosynthesis III
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- PHOSPHAGLYPSYN-RXN
- 4 associated gene(s):
- 4 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
