Difference between revisions of "CPD-8999"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009326001 == * left end position: ** 63544 * transcription direction: ** NEGATIVE * right end position: ** 65763 * centisome position: ** 29.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8999 CPD-8999] == * smiles: ** CSCCC(=O)C(=O)COP([O-])(=O)[O-] * inchi key: ** InChIKey=HKE...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8999 CPD-8999] == |
− | * | + | * smiles: |
− | ** | + | ** CSCCC(=O)C(=O)COP([O-])(=O)[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=HKEAOVFNWRDVAJ-UHFFFAOYSA-L |
− | * | + | * common name: |
− | ** | + | ** 5-(methylthio)-2,3-dioxopentyl 1-phosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 240.167 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 1-phosphoryloxy-2,3-diketo-5-methylthiopentane | ||
+ | ** 1-phospho-2,3-diketo-5-methylthiopentane | ||
+ | ** DKM-1-P | ||
+ | ** 2,3-diketo-5-methylthio 1-phosphopentane | ||
+ | ** 2,3-diketo-5-methylthiopentyl 1-phosphate | ||
+ | ** 5-(methylsulfanyl)-2,3-dioxopentyl phosphate | ||
+ | ** 5-methylthio-1-(phosphonooxy)pentane-2,3-dione | ||
+ | ** 5-(methylthio)-2,3-dioxopentyl phosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[R82-RXN]] |
− | * | + | * [[3.1.3.77-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * BIGG : dkmpp |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244990 25244990] |
− | {{#set: | + | * HMDB : HMDB59620 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15650 C15650] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58828 58828] | ||
+ | * METABOLIGHTS : MTBLC58828 | ||
+ | {{#set: smiles=CSCCC(=O)C(=O)COP([O-])(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=HKEAOVFNWRDVAJ-UHFFFAOYSA-L}} | ||
+ | {{#set: common name=5-(methylthio)-2,3-dioxopentyl 1-phosphate}} | ||
+ | {{#set: molecular weight=240.167 }} | ||
+ | {{#set: common name=1-phosphoryloxy-2,3-diketo-5-methylthiopentane|1-phospho-2,3-diketo-5-methylthiopentane|DKM-1-P|2,3-diketo-5-methylthio 1-phosphopentane|2,3-diketo-5-methylthiopentyl 1-phosphate|5-(methylsulfanyl)-2,3-dioxopentyl phosphate|5-methylthio-1-(phosphonooxy)pentane-2,3-dione|5-(methylthio)-2,3-dioxopentyl phosphate}} | ||
+ | {{#set: consumed by=R82-RXN|3.1.3.77-RXN}} |
Revision as of 14:54, 23 May 2018
Contents
Metabolite CPD-8999
- smiles:
- CSCCC(=O)C(=O)COP([O-])(=O)[O-]
- inchi key:
- InChIKey=HKEAOVFNWRDVAJ-UHFFFAOYSA-L
- common name:
- 5-(methylthio)-2,3-dioxopentyl 1-phosphate
- molecular weight:
- 240.167
- Synonym(s):
- 1-phosphoryloxy-2,3-diketo-5-methylthiopentane
- 1-phospho-2,3-diketo-5-methylthiopentane
- DKM-1-P
- 2,3-diketo-5-methylthio 1-phosphopentane
- 2,3-diketo-5-methylthiopentyl 1-phosphate
- 5-(methylsulfanyl)-2,3-dioxopentyl phosphate
- 5-methylthio-1-(phosphonooxy)pentane-2,3-dione
- 5-(methylthio)-2,3-dioxopentyl phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : dkmpp
- PUBCHEM:
- HMDB : HMDB59620
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58828
"CSCCC(=O)C(=O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.