Difference between revisions of "CPD-11876"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN1HP7-41 TRANS-RXN1HP7-41] == * direction: ** LEFT-TO-RIGHT * common name: ** TRANS-RXN1HP7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == * smiles: ** COC1(=C(O)C=CC(C(O)C=O)=C1) * inchi key: ** InChIKey=VISAJ...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == |
− | * | + | * smiles: |
− | ** | + | ** COC1(=C(O)C=CC(C(O)C=O)=C1) |
+ | * inchi key: | ||
+ | ** InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 3-methoxy-4-hydroxyphenylglycolaldehyde |
+ | * molecular weight: | ||
+ | ** 182.176 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** MOPEGAL | ||
+ | ** 4-hydroxy-3-methoxymandelaldehyde | ||
+ | ** 3-methoxy 4-hydroxy mandelic aldehyde | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-10917]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-10915]] | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658114 90658114] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.389601.html 389601] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05583 C05583] |
− | {{#set: | + | * HMDB : HMDB04061 |
+ | {{#set: smiles=COC1(=C(O)C=CC(C(O)C=O)=C1)}} | ||
+ | {{#set: inchi key=InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N}} | ||
+ | {{#set: common name=3-methoxy-4-hydroxyphenylglycolaldehyde}} | ||
+ | {{#set: molecular weight=182.176 }} | ||
+ | {{#set: common name=MOPEGAL|4-hydroxy-3-methoxymandelaldehyde|3-methoxy 4-hydroxy mandelic aldehyde}} | ||
+ | {{#set: consumed by=RXN-10917}} | ||
+ | {{#set: reversible reaction associated=RXN-10915}} |
Revision as of 14:56, 23 May 2018
Contents
Metabolite CPD-11876
- smiles:
- COC1(=C(O)C=CC(C(O)C=O)=C1)
- inchi key:
- InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N
- common name:
- 3-methoxy-4-hydroxyphenylglycolaldehyde
- molecular weight:
- 182.176
- Synonym(s):
- MOPEGAL
- 4-hydroxy-3-methoxymandelaldehyde
- 3-methoxy 4-hydroxy mandelic aldehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links