Difference between revisions of "GLC-6-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008570001 == * left end position: ** 31925 * transcription direction: ** NEGATIVE * right end position: ** 33142 * centisome position: ** 13.1...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene CHC_T00008570001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] ==
−
* left end position:
+
* smiles:
−
** 31925
+
** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
−
* right end position:
+
* common name:
−
** 33142
+
** β-D-glucose 6-phosphate
−
* centisome position:
+
* molecular weight:
−
** 13.10663    
+
** 258.121    
 
* Synonym(s):
 
* Synonym(s):
 +
** β-D-glucose-6-P
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[F16BDEPHOS-RXN]]
+
* [[RXN66-579]]
−
** original_genome
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
* [[RXN-16996]]
−
* [[GLUCONEO-PWY]]
+
* [[BETA-PHOSPHOGLUCOMUTASE-RXN]]
−
* [[GLYCOLYSIS]]
+
−
* [[SUCSYN-PWY]]
+
−
* [[CALVIN-PWY]]
+
−
* [[PWY-5484]]
+
−
* [[P185-PWY]]
+
−
* [[PWY66-399]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=31925}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604865 21604865]
−
{{#set: right end position=33142}}
+
* HMDB : HMDB03498
−
{{#set: centisome position=13.10663   }}
+
* LIGAND-CPD:
−
{{#set: reaction associated=F16BDEPHOS-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01172 C01172]
−
{{#set: pathway associated=GLUCONEO-PWY|GLYCOLYSIS|SUCSYN-PWY|CALVIN-PWY|PWY-5484|P185-PWY|PWY66-399}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.10239176.html 10239176]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58247 58247]
 +
* BIGG : g6p
 +
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O}}
 +
{{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L}}
 +
{{#set: common name=β-D-glucose 6-phosphate}}
 +
{{#set: molecular weight=258.121   }}
 +
{{#set: common name=β-D-glucose-6-P}}
 +
{{#set: consumed by=RXN66-579}}
 +
{{#set: reversible reaction associated=RXN-16996|BETA-PHOSPHOGLUCOMUTASE-RXN}}

Revision as of 14:59, 23 May 2018

Metabolite GLC-6-P

  • smiles:
    • C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
  • inchi key:
    • InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
  • common name:
    • β-D-glucose 6-phosphate
  • molecular weight:
    • 258.121
  • Synonym(s):
    • β-D-glucose-6-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=GLC-6-P&oldid=12806"