Difference between revisions of "4-AMINO-4-DEOXYCHORISMATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13064 RXN-13064] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C([N+])C...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13064 RXN-13064] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
+
** InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M
 +
* common name:
 +
** 4-amino-4-deoxychorismate
 +
* molecular weight:
 +
** 224.193   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[CPD-9446]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[D-mannopyranose]][c] '''+''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c]
+
== Reaction(s) of unknown directionality ==
* With common name(s):
+
* [[ADCLY-RXN]]
** 1 1,5-anhydro-D-mannitol[c] '''+''' 1 oxygen[c] '''+''' 1 a reduced [NADPH-hemoprotein reductase][c] '''=>''' 1 H2O[c] '''+''' 1 D-mannopyranose[c] '''+''' 1 an oxidized [NADPH-hemoprotein reductase][c]
+
* [[PABASYN-RXN]]
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00008799001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00009144001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00008302001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
* [[PWY-6992]], 1,5-anhydrofructose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6992 PWY-6992]
+
** '''3''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 97279-79-3
{{#set: ec number=EC-1.14.14.1}}
+
* PUBCHEM:
{{#set: gene associated=CHC_T00008799001_1|CHC_T00009144001_1|CHC_T00008302001_1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266632 45266632]
{{#set: in pathway=PWY-6992}}
+
* CHEBI:
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58406 58406]
{{#set: reconstruction tool=pantograph}}
+
* BIGG : 4adcho
{{#set: reconstruction source=galdieria.sulphuraria}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C11355 C11355]
 +
{{#set: smiles=C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)}}
 +
{{#set: inchi key=InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M}}
 +
{{#set: common name=4-amino-4-deoxychorismate}}
 +
{{#set: molecular weight=224.193    }}
 +
{{#set: reversible reaction associated=ADCLY-RXN|PABASYN-RXN}}

Revision as of 16:01, 23 May 2018

Metabolite 4-AMINO-4-DEOXYCHORISMATE

  • smiles:
    • C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)
  • inchi key:
    • InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M
  • common name:
    • 4-amino-4-deoxychorismate
  • molecular weight:
    • 224.193
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)" cannot be used as a page name in this wiki.