Difference between revisions of "CHC T00007865001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1...")
(Created page with "Category:Gene == Gene CHC_T00007865001_1 == * Synonym(s): == Reactions associated == * Reaction: ARGINYLTRANSFERASE-RXN ** Source: orthology-galdieria.sulphuraria...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] ==
+
== Gene CHC_T00007865001_1 ==
* smiles:
+
** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
+
* inchi key:
+
** InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J
+
* common name:
+
** 8-oxo-GTP
+
* molecular weight:
+
** 535.151   
+
 
* Synonym(s):
 
* Synonym(s):
** 8-oxo-guanosine-triphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ARGINYLTRANSFERASE-RXN]]
* [[RXN-11409]]
+
** Source: [[orthology-galdieria.sulphuraria]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=ARGINYLTRANSFERASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173271 46173271]
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: inchi key=InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J}}
+
{{#set: common name=8-oxo-GTP}}
+
{{#set: molecular weight=535.151    }}
+
{{#set: common name=8-oxo-guanosine-triphosphate}}
+
{{#set: produced by=RXN-11409}}
+

Latest revision as of 15:01, 23 May 2018

Gene CHC_T00007865001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links