Difference between revisions of "Acyl-Phosphates"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Acyl-Phosphates Acyl-Phosphates] == * common name: ** an acyl phosphate * Synonym(s): ** acyl p...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Acyl-Phosphates Acyl-Phosphates] ==
* smiles:
+
** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
* inchi key:
+
** InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N
+
 
* common name:
 
* common name:
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
+
** an acyl phosphate
* molecular weight:
+
** 444.74   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** acyl phosphate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-12]]
+
* [[ACYLPHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-11]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an acyl phosphate}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15698821 15698821]
+
{{#set: common name=acyl phosphate}}
* CHEBI:
+
{{#set: consumed by=ACYLPHOSPHATASE-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87057 87057]
+
* HMDB : HMDB12160
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: inchi key=InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N}}
+
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: molecular weight=444.74    }}
+
{{#set: consumed by=RXN66-12}}
+
{{#set: produced by=RXN66-11}}
+

Latest revision as of 15:01, 23 May 2018

Metabolite Acyl-Phosphates

  • common name:
    • an acyl phosphate
  • Synonym(s):
    • acyl phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links