Difference between revisions of "RXN-7669"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE PREPHENATE] == * smiles: ** C(=O)([O-])C(=O)CC1(C(=O)[O-])(C=CC(O)C=C1) * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7669 RXN-7669] == * direction: ** LEFT-TO-RIGHT * common name: ** 1,4-alpha-Glucan branching en...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7669 RXN-7669] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** 1,4-alpha-Glucan branching enzyme |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.18 EC-2.4.1.18] |
* Synonym(s): | * Synonym(s): | ||
+ | ** Amylo-(1,4-1,6)-transglycosylase | ||
+ | ** Amylo-(1,4 to 1,6)transglucosidase | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[POLY-GLUCOSYLATED-GLYCOGENINS]][c] '''=>''' 1 [[Glycogens]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 a glucosylated glycogenin[c] '''=>''' 1 a glycogen[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00008662001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00008662001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-5067]], glycogen biosynthesis II (from UDP-D-Glucose): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5067 PWY-5067] | ||
+ | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=1,4-alpha-Glucan branching enzyme}} | |
− | + | {{#set: ec number=EC-2.4.1.18}} | |
− | + | {{#set: common name=Amylo-(1,4-1,6)-transglycosylase|Amylo-(1,4 to 1,6)transglucosidase}} | |
− | + | {{#set: gene associated=CHC_T00008662001_1|CHC_T00008662001}} | |
− | + | {{#set: in pathway=PWY-5067}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-original_genome|orthology-galdieria.sulphuraria}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:02, 23 May 2018
Contents
Reaction RXN-7669
- direction:
- LEFT-TO-RIGHT
- common name:
- 1,4-alpha-Glucan branching enzyme
- ec number:
- Synonym(s):
- Amylo-(1,4-1,6)-transglycosylase
- Amylo-(1,4 to 1,6)transglucosidase
Reaction Formula
- With identifiers:
- 1 POLY-GLUCOSYLATED-GLYCOGENINS[c] => 1 Glycogens[c]
- With common name(s):
- 1 a glucosylated glycogenin[c] => 1 a glycogen[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008662001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00008662001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
Pathways
- PWY-5067, glycogen biosynthesis II (from UDP-D-Glucose): PWY-5067
- 2 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome