Difference between revisions of "NAD-BIOSYNTHESIS-II"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=NAD-BIOSYNTHESIS-II NAD-BIOSYNTHESIS-II] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=NAD-BIOSYNTHESIS-II NAD-BIOSYNTHESIS-II] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** NAD salvage pathway III |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** nicotinamide adenine dinucleotide salvage |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''3''' reactions found over '''5''' reactions in the full pathway |
− | + | * [[NADPYROPHOSPHAT-RXN]] | |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[CHC_T00000276001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | * [[RXN-5822]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[CHC_T00000494001_1]] | ||
+ | *** [[CHC_T00005741001_1]] | ||
+ | *** [[CHC_T00002031001_1]] | ||
+ | *** [[CHC_T00001956001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | * [[RXN-5841]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00008300001_1]] | ||
+ | *** [[CHC_T00000267001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-4106 PWY3O-4106] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-4106 PWY3O-4106] | ||
== External links == | == External links == | ||
− | {{#set: | + | * ECOCYC: |
− | {{#set: | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=NAD-BIOSYNTHESIS-II NAD-BIOSYNTHESIS-II] |
− | {{#set: common name= | + | {{#set: taxonomic range=TAX-2}} |
− | {{#set: | + | {{#set: common name=NAD salvage pathway III}} |
− | {{#set: | + | {{#set: common name=nicotinamide adenine dinucleotide salvage}} |
− | {{#set: | + | {{#set: reaction found=3}} |
+ | {{#set: total reaction=5}} | ||
+ | {{#set: completion rate=60.0}} |
Revision as of 15:07, 23 May 2018
Pathway NAD-BIOSYNTHESIS-II
- taxonomic range:
- common name:
- NAD salvage pathway III
- Synonym(s):
- nicotinamide adenine dinucleotide salvage
Reaction(s) found
3 reactions found over 5 reactions in the full pathway
- NADPYROPHOSPHAT-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-5822
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-5841
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: