Difference between revisions of "RXN66-11"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == * smiles: ** C(C1(C=C(C(=CC=1)O)O))=O * inchi key: ** InChIKey=IBGBGRVKPA...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-11 RXN66-11] == * direction: ** LEFT-TO-RIGHT * common name: ** 24,25-dihydrolanosterol 14-hy...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-11 RXN66-11] ==
* smiles:
+
* direction:
** C(C1(C=C(C(=CC=1)O)O))=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 3,4-dihydroxybenzaldehyde
+
** 24,25-dihydrolanosterol 14-hydroxylase
* molecular weight:
+
** 138.123   
+
 
* Synonym(s):
 
* Synonym(s):
** protocatechualdehyde
 
** 3,4-dihydroxybenzyl aldehyde
 
** rancinamycin IV
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-8872]]
+
** 1 [[NADPH]][c] '''+''' 1 [[CPD-8606]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-8607]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADPH[c] '''+''' 1 24,25-dihydrolanosterol[c] '''+''' 1 oxygen[c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 H2O[c] '''+''' 1 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009303001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY66-3]], cholesterol biosynthesis II (via 24,25-dihydrolanosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3]
 +
** '''15''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8768 8768]
+
{{#set: common name=24,25-dihydrolanosterol 14-hydroxylase}}
* CHEMSPIDER:
+
{{#set: gene associated=CHC_T00009303001_1}}
** [http://www.chemspider.com/Chemical-Structure.8438.html 8438]
+
{{#set: in pathway=PWY66-3}}
* CHEBI:
+
{{#set: reconstruction category=orthology}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50205 50205]
+
{{#set: reconstruction source=orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.genome.jp/dbget-bin/www_bget?C16700 C16700]
+
* HMDB : HMDB59965
+
{{#set: smiles=C(C1(C=C(C(=CC=1)O)O))=O}}
+
{{#set: inchi key=InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N}}
+
{{#set: common name=3,4-dihydroxybenzaldehyde}}
+
{{#set: molecular weight=138.123    }}
+
{{#set: common name=protocatechualdehyde|3,4-dihydroxybenzyl aldehyde|rancinamycin IV}}
+
{{#set: produced by=RXN-8872}}
+

Revision as of 15:08, 23 May 2018

Reaction RXN66-11

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 24,25-dihydrolanosterol 14-hydroxylase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NADPH[c] + 1 24,25-dihydrolanosterol[c] + 1 oxygen[c] + 1 H+[c] => 1 NADP+[c] + 1 H2O[c] + 1 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-3, cholesterol biosynthesis II (via 24,25-dihydrolanosterol): PWY66-3
    • 15 reactions found over 22 reactions in the full pathway

Reconstruction information

External links