Difference between revisions of "PWY-6955"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * smiles: ** C12(NC(=O)NC=1C(=O)NC(=O)N2) * inchi key: ** InChIKey=LEHOTFFKMJEO...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6955 PWY-6955] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6955 PWY-6955] ==
* smiles:
+
* taxonomic range:
** C12(NC(=O)NC=1C(=O)NC(=O)N2)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=LEHOTFFKMJEONL-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** urate
+
** lincomycin biosynthesis
* molecular weight:
+
** 168.112   
+
 
* Synonym(s):
 
* Synonym(s):
** 2,6,8-trioxypurine
 
** purine-2,6,8-(1H,3H,9H)-trione
 
** 7,9-dihydro-1H-purine-2,6,8(3H)-trione
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[URATE-OXIDASE-RXN]]
+
'''1''' reactions found over '''8''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-5861]]
* [[XANTHINE-OXIDASE-RXN]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00005217001_1]]
* [[RXN0-901]]
+
** 2 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12851 RXN-12851]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12852 RXN-12852]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12854 RXN-12854]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12855 RXN-12855]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12859 RXN-12859]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12860 RXN-12860]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=STIZOLOBINATE-SYNTHASE-RXN STIZOLOBINATE-SYNTHASE-RXN]
 
== External links  ==
 
== External links  ==
* CAS : 69-93-2
+
{{#set: taxonomic range=TAX-2}}
* Wikipedia : Uric_acid
+
{{#set: common name=lincomycin biosynthesis}}
* METABOLIGHTS : MTBLC17775
+
{{#set: reaction found=1}}
* DRUGBANK : DB01696
+
{{#set: total reaction=8}}
* PUBCHEM:
+
{{#set: completion rate=13.0}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229235 44229235]
+
* HMDB : HMDB00289
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00366 C00366]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17775 17775]
+
* BIGG : urate
+
{{#set: smiles=C12(NC(=O)NC=1C(=O)NC(=O)N2)}}
+
{{#set: inchi key=InChIKey=LEHOTFFKMJEONL-UHFFFAOYSA-N}}
+
{{#set: common name=urate}}
+
{{#set: molecular weight=168.112    }}
+
{{#set: common name=2,6,8-trioxypurine|purine-2,6,8-(1H,3H,9H)-trione|7,9-dihydro-1H-purine-2,6,8(3H)-trione}}
+
{{#set: consumed by=URATE-OXIDASE-RXN}}
+
{{#set: produced by=XANTHINE-OXIDASE-RXN}}
+
{{#set: consumed or produced by=RXN0-901}}
+

Revision as of 16:10, 23 May 2018

Pathway PWY-6955

  • taxonomic range:
  • common name:
    • lincomycin biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links