Difference between revisions of "ADP-D-Ribosyl-Acceptors"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15717 CPD-15717] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-Ribosyl-Acceptors ADP-D-Ribosyl-Acceptors] == * common name: ** an ADP-D-ribosyl acceptor...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-Ribosyl-Acceptors ADP-D-Ribosyl-Acceptors] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an ADP-D-ribosyl acceptor |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=an ADP-D-ribosyl acceptor}} | |
− | + | {{#set: reversible reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 16:10, 23 May 2018
Contents
Metabolite ADP-D-Ribosyl-Acceptors
- common name:
- an ADP-D-ribosyl acceptor
- Synonym(s):