Difference between revisions of "PWY-6607"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * smiles: ** C(NC(N)=[N+])CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=ODKSFYDXXFIFQ...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6607 PWY-6607] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6607 PWY-6607] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** guanosine nucleotides degradation I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''2''' reactions found over '''4''' reactions in the full pathway |
| − | * [[ | + | * [[RXN-7609]] |
| − | + | ** 2 associated gene(s): | |
| − | + | *** [[CHC_T00008300001_1]] | |
| − | * [[ | + | *** [[CHC_T00000267001_1]] |
| − | * [[ | + | ** 3 reconstruction source(s) associated: |
| − | * [ | + | *** [[orthology-arabidopsis_thaliana]] |
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | * [[RXN0-901]] | ||
| + | ** 3 associated gene(s): | ||
| + | *** [[CHC_T00006216001_1]] | ||
| + | *** [[CHC_T00006932001_1]] | ||
| + | *** [[CHC_T00000194001_1]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-DEAMINASE-RXN GUANOSINE-DEAMINASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN0-363 RXN0-363] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-3193}} | |
| − | + | {{#set: common name=guanosine nucleotides degradation I}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:11, 23 May 2018
Pathway PWY-6607
- taxonomic range:
- common name:
- guanosine nucleotides degradation I
- Synonym(s):
Reaction(s) found
2 reactions found over 4 reactions in the full pathway
- RXN-7609
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN0-901
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
