Difference between revisions of "CHC T00009379001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENIC_ACID LINOLENIC_ACID] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC(=O)[O-] * inchi key: ** In...") |
(Created page with "Category:Gene == Gene CHC_T00009379001 == * left end position: ** 2589 * transcription direction: ** POSITIVE * right end position: ** 5078 * centisome position: ** 6.6096...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009379001 == |
− | * | + | * left end position: |
− | ** | + | ** 2589 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5078 |
− | * | + | * centisome position: |
− | ** | + | ** 6.60965 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[MALTODEXGLUCOSID-RXN]] |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | * [[RXN- | + | *** Assignment: automated-name-match |
− | + | * Reaction: [[RXN-14281]] | |
− | == | + | ** Source: [[annotation-original_genome]] |
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-14282]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-14283]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-15910]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN0-5183]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-842]] | ||
+ | * [[GLYCOCAT-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2589}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5078}} | |
− | + | {{#set: centisome position=6.60965 }} | |
− | + | {{#set: reaction associated=MALTODEXGLUCOSID-RXN|RXN-14281|RXN-14282|RXN-14283|RXN-15910|RXN0-5183}} | |
− | + | {{#set: pathway associated=PWY-842|GLYCOCAT-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 15:11, 23 May 2018
Gene CHC_T00009379001
- left end position:
- 2589
- transcription direction:
- POSITIVE
- right end position:
- 5078
- centisome position:
- 6.60965
- Synonym(s):
Reactions associated
- Reaction: MALTODEXGLUCOSID-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-14281
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-14282
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-14283
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-15910
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN0-5183
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome