Difference between revisions of "URATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UROPORIIIMETHYLTRANSA-RXN UROPORIIIMETHYLTRANSA-RXN] == * direction: ** LEFT-TO-RIGHT * Synonym(s):...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * smiles: ** C12(NC(=O)NC=1C(=O)NC(=O)N2) * inchi key: ** InChIKey=LEHOTFFKMJEO...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == |
− | * | + | * smiles: |
− | ** | + | ** C12(NC(=O)NC=1C(=O)NC(=O)N2) |
+ | * inchi key: | ||
+ | ** InChIKey=LEHOTFFKMJEONL-UHFFFAOYSA-N | ||
+ | * common name: | ||
+ | ** urate | ||
+ | * molecular weight: | ||
+ | ** 168.112 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2,6,8-trioxypurine |
− | + | ** purine-2,6,8-(1H,3H,9H)-trione | |
− | ** | + | ** 7,9-dihydro-1H-purine-2,6,8(3H)-trione |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | ** | + | |
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[URATE-OXIDASE-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[XANTHINE-OXIDASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN0-901]] | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 69-93-2 |
− | ** [http:// | + | * Wikipedia : Uric_acid |
− | * LIGAND- | + | * METABOLIGHTS : MTBLC17775 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * DRUGBANK : DB01696 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229235 44229235] |
− | {{#set: | + | * HMDB : HMDB00289 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00366 C00366] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17775 17775] |
+ | * BIGG : urate | ||
+ | {{#set: smiles=C12(NC(=O)NC=1C(=O)NC(=O)N2)}} | ||
+ | {{#set: inchi key=InChIKey=LEHOTFFKMJEONL-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=urate}} | ||
+ | {{#set: molecular weight=168.112 }} | ||
+ | {{#set: common name=2,6,8-trioxypurine|purine-2,6,8-(1H,3H,9H)-trione|7,9-dihydro-1H-purine-2,6,8(3H)-trione}} | ||
+ | {{#set: consumed by=URATE-OXIDASE-RXN}} | ||
+ | {{#set: produced by=XANTHINE-OXIDASE-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN0-901}} |
Revision as of 15:11, 23 May 2018
Contents
Metabolite URATE
- smiles:
- C12(NC(=O)NC=1C(=O)NC(=O)N2)
- inchi key:
- InChIKey=LEHOTFFKMJEONL-UHFFFAOYSA-N
- common name:
- urate
- molecular weight:
- 168.112
- Synonym(s):
- 2,6,8-trioxypurine
- purine-2,6,8-(1H,3H,9H)-trione
- 7,9-dihydro-1H-purine-2,6,8(3H)-trione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 69-93-2
- Wikipedia : Uric_acid
- METABOLIGHTS : MTBLC17775
- DRUGBANK : DB01696
- PUBCHEM:
- HMDB : HMDB00289
- LIGAND-CPD:
- CHEBI:
- BIGG : urate