Difference between revisions of "CPD-7063"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00006177001_1 == * Synonym(s): == Reactions associated == * RXN-11598 ** pantograph-galdieria.sulphuraria * RXN-14177 ** pant...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] == * smiles: ** CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] == |
+ | * smiles: | ||
+ | ** CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O)[O-])C(C)C(N=2)=CC3(C(C)=C(C=C)C(=O)N3)))=C(N4)5)))C=O) | ||
+ | * inchi key: | ||
+ | ** InChIKey=GVTPYCXGTFQZDT-YSSUGPPCSA-M | ||
+ | * common name: | ||
+ | ** red chlorophyll catabolite | ||
+ | * molecular weight: | ||
+ | ** 624.692 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** RCC | ||
+ | ** red bilin | ||
+ | ** (7S,8S,101R)-8-(2-carboxyethyl)-17-ethyl-19-formyl-101-(methoxycarbonyl)-3,7,13,18-tetramethyl-2-vinyl-8,23-dihydro-7H-10,12-ethanobiladiene-ab-1,102(21H)-dione | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-7740]] | |
− | * [[RXN- | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820276 91820276] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58716 58716] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C18022 C18022] | ||
+ | {{#set: smiles=CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O)[O-])C(C)C(N=2)=CC3(C(C)=C(C=C)C(=O)N3)))=C(N4)5)))C=O)}} | ||
+ | {{#set: inchi key=InChIKey=GVTPYCXGTFQZDT-YSSUGPPCSA-M}} | ||
+ | {{#set: common name=red chlorophyll catabolite}} | ||
+ | {{#set: molecular weight=624.692 }} | ||
+ | {{#set: common name=RCC|red bilin|(7S,8S,101R)-8-(2-carboxyethyl)-17-ethyl-19-formyl-101-(methoxycarbonyl)-3,7,13,18-tetramethyl-2-vinyl-8,23-dihydro-7H-10,12-ethanobiladiene-ab-1,102(21H)-dione}} | ||
+ | {{#set: produced by=RXN-7740}} |
Revision as of 15:12, 23 May 2018
Contents
Metabolite CPD-7063
- smiles:
- CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O)[O-])C(C)C(N=2)=CC3(C(C)=C(C=C)C(=O)N3)))=C(N4)5)))C=O)
- inchi key:
- InChIKey=GVTPYCXGTFQZDT-YSSUGPPCSA-M
- common name:
- red chlorophyll catabolite
- molecular weight:
- 624.692
- Synonym(s):
- RCC
- red bilin
- (7S,8S,101R)-8-(2-carboxyethyl)-17-ethyl-19-formyl-101-(methoxycarbonyl)-3,7,13,18-tetramethyl-2-vinyl-8,23-dihydro-7H-10,12-ethanobiladiene-ab-1,102(21H)-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O)[O-])C(C)C(N=2)=CC3(C(C)=C(C=C)C(=O)N3)))=C(N4)5)))C=O)" cannot be used as a page name in this wiki.