Difference between revisions of "CHC T00008821001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] == * smiles: ** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2)) * inchi key: ** InChIKey=QIVB...") |
(Created page with "Category:Gene == Gene CHC_T00008821001 == * left end position: ** 50673 * transcription direction: ** NEGATIVE * right end position: ** 51590 * centisome position: ** 21.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008821001 == |
− | * | + | * left end position: |
− | ** | + | ** 50673 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 51590 |
− | * | + | * centisome position: |
− | ** | + | ** 21.82187 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[NAPHTHOATE-SYN-RXN]] |
− | * | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | * | + | == Pathways associated == |
− | == | + | * [[PWY-5837]] |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=50673}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=51590}} | |
− | + | {{#set: centisome position=21.82187 }} | |
− | + | {{#set: reaction associated=NAPHTHOATE-SYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-5837}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 16:19, 23 May 2018
Gene CHC_T00008821001
- left end position:
- 50673
- transcription direction:
- NEGATIVE
- right end position:
- 51590
- centisome position:
- 21.82187
- Synonym(s):
Reactions associated
- Reaction: NAPHTHOATE-SYN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome