Difference between revisions of "CPD-12122"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10062 RXN-10062] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-hexacos-2-enoyl-[acp]...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12122 CPD-12122] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10062 RXN-10062] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12122 CPD-12122] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C)C
 +
* inchi key:
 +
** InChIKey=HPJVTYODWHYFMV-ZNWIKROFSA-N
 
* common name:
 
* common name:
−
** trans-hexacos-2-enoyl-[acp] reductase
+
** demethylmenaquinol-13
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
+
** 1045.709   
 
* Synonym(s):
 
* Synonym(s):
 +
** DMKH2-13
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-9366]]
−
** 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[Trans-D2-hexacos-2-enoyl-ACPs]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Cerotoyl-ACPs]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 a trans-hexacos-2-enoyl-[acp][c] '''=>''' 1 NAD+[c] '''+''' 1 a cerotoyl-[acp][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00009325001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY-6113]], superpathway of mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6113 PWY-6113]
+
−
** '''7''' reactions found over '''12''' reactions in the full pathway
+
−
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
−
** '''29''' reactions found over '''182''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=trans-hexacos-2-enoyl-[acp] reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479647 45479647]
−
{{#set: ec number=EC-1.3.1.9}}
+
* CHEBI:
−
{{#set: gene associated=CHC_T00009325001_1}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84553 84553]
−
{{#set: in pathway=PWY-6113|PWYG-321}}
+
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C)C}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=HPJVTYODWHYFMV-ZNWIKROFSA-N}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=demethylmenaquinol-13}}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: molecular weight=1045.709    }}
 +
{{#set: common name=DMKH2-13}}
 +
{{#set: consumed by=RXN-9366}}

Revision as of 15:19, 23 May 2018

Metabolite CPD-12122

  • smiles:
    • CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C)C
  • inchi key:
    • InChIKey=HPJVTYODWHYFMV-ZNWIKROFSA-N
  • common name:
    • demethylmenaquinol-13
  • molecular weight:
    • 1045.709
  • Synonym(s):
    • DMKH2-13

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-12122&oldid=13985"