Difference between revisions of "RXN-9363"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] == * smiles: ** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9363 RXN-9363] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9363 RXN-9363] ==
* smiles:
+
* direction:
** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J
+
** [http://enzyme.expasy.org/EC/2.1.1.163 EC-2.1.1.163]
* common name:
+
** (S)-3-hydroxy-(5Z)-tetradecenoyl-CoA
+
* molecular weight:
+
** 987.845   
+
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-5-cis-tetradecenoyl-CoA
 
** (S)-3-hydroxy-14:1-Δ5-CoA
 
** (3S)-hydroxy-5-cis-tetradecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN0-5393]]
+
** 1 [[CPD-12121]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-12129]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 demethylmenaquinol-12[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 H+[c] '''+''' 1 menaquinol-12[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00000214001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00001339001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00000517001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00005416001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-5892]], menaquinol-12 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5892 PWY-5892]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244729 25244729]
+
{{#set: ec number=EC-2.1.1.163}}
{{#set: smiles=CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: gene associated=CHC_T00000214001_1|CHC_T00001339001_1|CHC_T00000517001_1|CHC_T00005416001_1}}
{{#set: inchi key=InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J}}
+
{{#set: in pathway=PWY-5892}}
{{#set: common name=(S)-3-hydroxy-(5Z)-tetradecenoyl-CoA}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=987.845    }}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
{{#set: common name=(S)-3-hydroxy-5-cis-tetradecenoyl-CoA|(S)-3-hydroxy-14:1-Δ5-CoA|(3S)-hydroxy-5-cis-tetradecenoyl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: produced by=RXN0-5393}}
+

Latest revision as of 15:19, 23 May 2018

Reaction RXN-9363

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5892, menaquinol-12 biosynthesis: PWY-5892
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links