Difference between revisions of "CHC T00010085001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * smiles: ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) * inchi key: *...") |
(Created page with "Category:Gene == Gene CHC_T00010085001 == * left end position: ** 335895 * transcription direction: ** POSITIVE * right end position: ** 336989 * centisome position: ** 84...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene CHC_T00010085001 == |
| − | * | + | * left end position: |
| − | ** | + | ** 335895 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 336989 |
| − | * | + | * centisome position: |
| − | ** | + | ** 84.32899 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[RXN-11135]] | |
| − | + | ** Source: [[annotation-original_genome]] | |
| − | * [[ | + | *** Assignment: automated-name-match |
| − | == | + | == Pathways associated == |
== External links == | == External links == | ||
| − | + | {{#set: left end position=335895}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: right end position=336989}} | |
| − | + | {{#set: centisome position=84.32899 }} | |
| − | + | {{#set: reaction associated=RXN-11135}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:19, 23 May 2018
Gene CHC_T00010085001
- left end position:
- 335895
- transcription direction:
- POSITIVE
- right end position:
- 336989
- centisome position:
- 84.32899
- Synonym(s):
Reactions associated
- Reaction: RXN-11135
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
