Difference between revisions of "CPD-12117"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008731001 == * left end position: ** 152480 * transcription direction: ** POSITIVE * right end position: ** 153352 * centisome position: ** 70...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12117 CPD-12117] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12117 CPD-12117] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=UFZDIMBXTVRBDS-SSQLMYNASA-N |
− | * | + | * common name: |
− | ** | + | ** demethylmenaquinol-7 |
− | * | + | * molecular weight: |
− | ** | + | ** 636.999 |
* Synonym(s): | * Synonym(s): | ||
+ | ** DMKH2-7 | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-9191]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479205 45479205] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64806 64806] |
− | {{#set: | + | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C}} |
+ | {{#set: inchi key=InChIKey=UFZDIMBXTVRBDS-SSQLMYNASA-N}} | ||
+ | {{#set: common name=demethylmenaquinol-7}} | ||
+ | {{#set: molecular weight=636.999 }} | ||
+ | {{#set: common name=DMKH2-7}} | ||
+ | {{#set: consumed by=RXN-9191}} |
Revision as of 16:22, 23 May 2018
Contents
Metabolite CPD-12117
- smiles:
- CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C
- inchi key:
- InChIKey=UFZDIMBXTVRBDS-SSQLMYNASA-N
- common name:
- demethylmenaquinol-7
- molecular weight:
- 636.999
- Synonym(s):
- DMKH2-7
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links