Difference between revisions of "CPD-14926"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Chap-ATP-Co-chaperone-SP-2Fe2S-Complex Chap-ATP-Co-chaperone-SP-2Fe2S-Complex] == * common name...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * inchi key: ** InChIKe...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Chap-ATP-Co-chaperone-SP-2Fe2S-Complex Chap-ATP-Co-chaperone-SP-2Fe2S-Complex] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] ==
 +
* smiles:
 +
** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O
 +
* inchi key:
 +
** InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N
 
* common name:
 
* common name:
** a [chaperone-ATP]-[co-chaperone]-[scaffold protein-(2Fe-2S)] complex
+
** phytenal
 +
* molecular weight:
 +
** 294.52   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2E-phytenal
 +
** 3,7,11,15-tetramethyl-2E-hexadecenal
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14390]]
+
* [[RXN66-479]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14389]]
+
* [[RXN66-478]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a [chaperone-ATP]-[co-chaperone]-[scaffold protein-(2Fe-2S)] complex}}
+
* LIPID_MAPS : LMPR0104010025
{{#set: consumed by=RXN-14390}}
+
* PUBCHEM:
{{#set: produced by=RXN-14389}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9900764 9900764]
 +
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O}}
 +
{{#set: inchi key=InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N}}
 +
{{#set: common name=phytenal}}
 +
{{#set: molecular weight=294.52    }}
 +
{{#set: common name=2E-phytenal|3,7,11,15-tetramethyl-2E-hexadecenal}}
 +
{{#set: consumed by=RXN66-479}}
 +
{{#set: produced by=RXN66-478}}

Revision as of 15:25, 23 May 2018

Metabolite CPD-14926

  • smiles:
    • CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O
  • inchi key:
    • InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N
  • common name:
    • phytenal
  • molecular weight:
    • 294.52
  • Synonym(s):
    • 2E-phytenal
    • 3,7,11,15-tetramethyl-2E-hexadecenal

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • LIPID_MAPS : LMPR0104010025
  • PUBCHEM:
"CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O" cannot be used as a page name in this wiki.