Difference between revisions of "PWY-6976"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UMP UMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6976 PWY-6976] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6976 PWY-6976] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** dTDP-L-mycarose biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''7''' reactions in the full pathway |
| − | * [[ | + | * [[DTDPGLUCDEHYDRAT-RXN]] |
| − | + | ** 4 associated gene(s): | |
| − | * [[ | + | *** [[CHC_T00009237001_1]] |
| − | * [[ | + | *** [[CHC_T00009237001]] |
| − | * [[ | + | *** [[CHC_T00008950001_1]] |
| − | * [[ | + | *** [[CHC_T00008912001_1]] |
| − | * [[ | + | ** 4 reconstruction source(s) associated: |
| − | * [[ | + | *** [[annotation-original_genome]] |
| − | * [[ | + | *** [[orthology-arabidopsis_thaliana]] |
| − | == Reaction(s) | + | *** [[orthology-ectocarpus_siliculosus]] |
| − | * [[ | + | *** [[orthology-galdieria.sulphuraria]] |
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=DTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12404 RXN-12404] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12935 RXN-12935] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12940 RXN-12940] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12941 RXN-12941] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12942 RXN-12942] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=dTDP-L-mycarose biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=7}} | |
| − | + | {{#set: completion rate=14.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:26, 23 May 2018
Pathway PWY-6976
- taxonomic range:
- common name:
- dTDP-L-mycarose biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 7 reactions in the full pathway
- DTDPGLUCDEHYDRAT-RXN
- 4 associated gene(s):
- 4 reconstruction source(s) associated:
