Difference between revisions of "CPD-8619"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-]...") |
|||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C |
| − | ** | + | * inchi key: |
| + | ** InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M | ||
* common name: | * common name: | ||
| − | ** & | + | ** 4α-carboxy-5α-cholesta-8-en-3β-ol |
| + | * molecular weight: | ||
| + | ** 429.662 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN66-23]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-13710]] | |
| − | * [[RXN- | + | * [[RXN66-22]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826593 91826593] |
| − | {{#set: common name=& | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87055 87055] |
| − | {{#set: | + | * HMDB : HMDB12166 |
| − | {{#set: | + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C}} |
| − | + | {{#set: inchi key=InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M}} | |
| + | {{#set: common name=4α-carboxy-5α-cholesta-8-en-3β-ol}} | ||
| + | {{#set: molecular weight=429.662 }} | ||
| + | {{#set: consumed by=RXN66-23}} | ||
| + | {{#set: produced by=RXN-13710|RXN66-22}} | ||
Revision as of 15:28, 23 May 2018
Contents
Metabolite CPD-8619
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
- inchi key:
- InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
- common name:
- 4α-carboxy-5α-cholesta-8-en-3β-ol
- molecular weight:
- 429.662
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.
