Difference between revisions of "CHC T00008329001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LL-DIAMINOPIMELATE LL-DIAMINOPIMELATE] == * smiles: ** C(C(CCCC(C([O-])=O)[N+])[N+])([O-])=O *...") |
(Created page with "Category:Gene == Gene CHC_T00008329001 == * left end position: ** 7002 * transcription direction: ** POSITIVE * right end position: ** 10911 * centisome position: ** 2.929...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008329001 == |
− | * | + | * left end position: |
− | ** | + | ** 7002 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 10911 |
− | * | + | * centisome position: |
− | ** | + | ** 2.9294865 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN0-4261]] | |
− | + | ** Source: [[annotation-original_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=7002}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=10911}} | |
− | + | {{#set: centisome position=2.9294865 }} | |
− | + | {{#set: reaction associated=RXN0-4261}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 15:30, 23 May 2018
Gene CHC_T00008329001
- left end position:
- 7002
- transcription direction:
- POSITIVE
- right end position:
- 10911
- centisome position:
- 2.9294865
- Synonym(s):
Reactions associated
- Reaction: RXN0-4261
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome