Difference between revisions of "CPD-332"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] == * smiles: ** CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2)) * inchi key: ** InChIKey=XXFA...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2))
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* inchi key:
 +
** InChIKey=XXFACTAYGKKOQB-ZETCQYMHSA-N
 
* common name:
 
* common name:
** palmitate biosynthesis II (bacteria and plants)
+
** dihydrozeatin
 +
* molecular weight:
 +
** 221.261   
 
* Synonym(s):
 
* Synonym(s):
** palmitic acid biosynthesis
+
** 2-Methyl-4-(1H-purin-6-ylamino)butan-1-ol
** de novo lipogenesis
+
** N6-(4-Hydroxyisopentanyl)adenine
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''31''' reactions found over '''31''' reactions in the full pathway
+
* [[RXN-4726]]
* [[3.1.2.21-RXN]]
+
== Reaction(s) known to produce the compound ==
* [[4.2.1.58-RXN]]
+
== Reaction(s) of unknown directionality ==
* [[4.2.1.59-RXN]]
+
* [[4.2.1.61-RXN]]
+
* [[RXN-16393]]
+
* [[RXN-9514]]
+
* [[RXN-9516]]
+
* [[RXN-9518]]
+
* [[RXN-9520]]
+
* [[RXN-9523]]
+
* [[RXN-9524]]
+
* [[RXN-9527]]
+
* [[RXN-9528]]
+
* [[RXN-9531]]
+
* [[RXN-9532]]
+
* [[RXN-9533]]
+
* [[RXN-9535]]
+
* [[RXN-9536]]
+
* [[RXN-9537]]
+
* [[RXN-9539]]
+
* [[RXN-9540]]
+
* [[RXN-9549]]
+
* [[RXN-9623]]
+
* [[RXN-9655]]
+
* [[RXN-9657]]
+
* [[RXN-9658]]
+
* [[RXN-9659]]
+
* [[RXN-9660]]
+
* [[RXN-9661]]
+
* [[RXN-9662]]
+
* [[RXN-9663]]
+
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
* ECOCYC:
+
* CAS : 23599-75-9
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5971 PWY-5971]
+
* PUBCHEM:
{{#set: taxonomic range=TAX-33090}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439631 439631]
{{#set: taxonomic range=TAX-2}}
+
* HMDB : HMDB12215
{{#set: common name=palmitate biosynthesis II (bacteria and plants)}}
+
* LIGAND-CPD:
{{#set: common name=palmitic acid biosynthesis|de novo lipogenesis}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02029 C02029]
{{#set: reaction found=31}}
+
* CHEMSPIDER:
{{#set: reaction not found=31}}
+
** [http://www.chemspider.com/Chemical-Structure.388705.html 388705]
{{#set: completion rate=100.0}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17874 17874]
 +
{{#set: smiles=CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2))}}
 +
{{#set: inchi key=InChIKey=XXFACTAYGKKOQB-ZETCQYMHSA-N}}
 +
{{#set: common name=dihydrozeatin}}
 +
{{#set: molecular weight=221.261    }}
 +
{{#set: common name=2-Methyl-4-(1H-purin-6-ylamino)butan-1-ol|N6-(4-Hydroxyisopentanyl)adenine}}
 +
{{#set: consumed by=RXN-4726}}

Revision as of 15:36, 23 May 2018

Metabolite CPD-332

  • smiles:
    • CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2))
  • inchi key:
    • InChIKey=XXFACTAYGKKOQB-ZETCQYMHSA-N
  • common name:
    • dihydrozeatin
  • molecular weight:
    • 221.261
  • Synonym(s):
    • 2-Methyl-4-(1H-purin-6-ylamino)butan-1-ol
    • N6-(4-Hydroxyisopentanyl)adenine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links