Difference between revisions of "9S-RRNA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] == * smiles: ** C(O)C(O)C([N+])C(=O)[O-] * inchi key: ** InChIKey=JBNUARFQ...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=9S-RRNA 9S-RRNA] == * common name: ** a 9S rRNA * Synonym(s): == Reaction(s) known to consume...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=9S-RRNA 9S-RRNA] ==
* smiles:
+
** C(O)C(O)C([N+])C(=O)[O-]
+
* inchi key:
+
** InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N
+
 
* common name:
 
* common name:
** 4-hydroxy-L-threonine
+
** a 9S rRNA
* molecular weight:
+
** 135.119   
+
 
* Synonym(s):
 
* Synonym(s):
** (2S,3S)-2-amino-3,4-dihydroxybutanoic acid
 
** hydroxythreonine
 
** 3-hydroxyhomoserine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-6522]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14125]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 21768-45-6
+
{{#set: common name=a 9S rRNA}}
* PUBCHEM:
+
{{#set: consumed by=RXN0-6522}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852420 49852420]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06056 C06056]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.167988.html 167988]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60904 60904]
+
* BIGG : 4hthr
+
{{#set: smiles=C(O)C(O)C([N+])C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N}}
+
{{#set: common name=4-hydroxy-L-threonine}}
+
{{#set: molecular weight=135.119    }}
+
{{#set: common name=(2S,3S)-2-amino-3,4-dihydroxybutanoic acid|hydroxythreonine|3-hydroxyhomoserine}}
+
{{#set: produced by=RXN-14125}}
+

Latest revision as of 16:41, 23 May 2018

Metabolite 9S-RRNA

  • common name:
    • a 9S rRNA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links