Difference between revisions of "CPD-12118"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12118 CPD-12118] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12118 CPD-12118] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763]
+
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682]
+
* inchi key:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** InChIKey=WJUVWMHFGHNQJZ-RNFPTGGASA-N
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
 
* common name:
 
* common name:
−
** 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent)
+
** demethylmenaquinol-9
 +
* molecular weight:
 +
** 773.236   
 
* Synonym(s):
 
* Synonym(s):
−
** light-dependent aerobic 3,8-divinyl-chlorophyllide a biosynthesis I
+
** DMKH2-9
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''9''' reactions found over '''9''' reactions in the full pathway
+
* [[RXN-9205]]
−
* [[PROTOPORGENOXI-RXN]]
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-5282]]
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-5283]]
+
−
* [[RXN-5284]]
+
−
* [[RXN-5285]]
+
−
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
+
−
* [[RXN0-1461]]
+
−
* [[RXN1F-20]]
+
−
* [[UROGENDECARBOX-RXN]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2763}}
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-33682}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479709 45479709]
−
{{#set: taxonomic range=TAX-2}}
+
* CHEBI:
−
{{#set: taxonomic range=TAX-33090}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84542 84542]
−
{{#set: common name=3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent)}}
+
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C}}
−
{{#set: common name=light-dependent aerobic 3,8-divinyl-chlorophyllide a biosynthesis I}}
+
{{#set: inchi key=InChIKey=WJUVWMHFGHNQJZ-RNFPTGGASA-N}}
−
{{#set: reaction found=9}}
+
{{#set: common name=demethylmenaquinol-9}}
−
{{#set: reaction not found=9}}
+
{{#set: molecular weight=773.236    }}
−
{{#set: completion rate=100.0}}
+
{{#set: common name=DMKH2-9}}
 +
{{#set: consumed by=RXN-9205}}

Revision as of 15:41, 23 May 2018

Metabolite CPD-12118

  • smiles:
    • CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C
  • inchi key:
    • InChIKey=WJUVWMHFGHNQJZ-RNFPTGGASA-N
  • common name:
    • demethylmenaquinol-9
  • molecular weight:
    • 773.236
  • Synonym(s):
    • DMKH2-9

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-12118&oldid=15008"