Difference between revisions of "CPD-19161"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] == * smiles: ** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...") |
|||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] == |
− | * | + | * smiles: |
− | ** [ | + | ** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** (2E,7Z)-tetradecenoyl-CoA |
+ | * molecular weight: | ||
+ | ** 969.83 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 14:2-Δ2,Δ7-CoA | ||
+ | ** 2-trans,7-cis-tetradecenoyl-CoA | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-17793]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | == Reaction(s) | + | * [[RXN-17792]] |
− | * [ | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: smiles=CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | {{#set: | + | {{#set: inchi key=InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J}} |
− | {{#set: common name= | + | {{#set: common name=(2E,7Z)-tetradecenoyl-CoA}} |
− | {{#set: | + | {{#set: molecular weight=969.83 }} |
− | {{#set: | + | {{#set: common name=14:2-Δ2,Δ7-CoA|2-trans,7-cis-tetradecenoyl-CoA}} |
− | {{#set: | + | {{#set: consumed by=RXN-17793}} |
+ | {{#set: produced by=RXN-17792}} |
Revision as of 15:43, 23 May 2018
Contents
Metabolite CPD-19161
- smiles:
- CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J
- common name:
- (2E,7Z)-tetradecenoyl-CoA
- molecular weight:
- 969.83
- Synonym(s):
- 14:2-Δ2,Δ7-CoA
- 2-trans,7-cis-tetradecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.