Difference between revisions of "RXN-12729"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] == * smiles: ** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12729 RXN-12729] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12729 RXN-12729] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J
+
** [http://enzyme.expasy.org/EC/4.4.1.8 EC-4.4.1.8]
−
* common name:
+
−
** (5Z)-tetradecenoyl-CoA
+
−
* molecular weight:
+
−
** 971.845   
+
 
* Synonym(s):
 
* Synonym(s):
−
** cis-tetradec-5-enoyl-CoA
 
−
** 14:1 cis-5
 
−
** 14:1(n-9)
 
−
** (5Z)-tetradec-5-enoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14576]]
+
* With identifiers:
−
* [[RXN-17783]]
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-13717]][c] '''=>''' 1 [[SELENOHOMOCYSTEINE]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[PYRUVATE]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN-17782]]
+
** 1 H2O[c] '''+''' 1 L-selenocystathionine[c] '''=>''' 1 seleno-L-homocysteine[c] '''+''' 1 ammonium[c] '''+''' 1 pyruvate[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008829001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-6936]], seleno-amino acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6936 PWY-6936]
 +
** '''4''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659071 90659071]
+
{{#set: ec number=EC-4.4.1.8}}
−
* CHEBI:
+
{{#set: gene associated=CHC_T00008829001_1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84650 84650]
+
{{#set: in pathway=PWY-6936}}
−
{{#set: smiles=CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
−
{{#set: common name=(5Z)-tetradecenoyl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=971.845    }}
+
−
{{#set: common name=cis-tetradec-5-enoyl-CoA|14:1 cis-5|14:1(n-9)|(5Z)-tetradec-5-enoyl-CoA}}
+
−
{{#set: consumed by=RXN-14576|RXN-17783}}
+
−
{{#set: produced by=RXN-17782}}
+

Latest revision as of 15:45, 23 May 2018

Reaction RXN-12729

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6936, seleno-amino acid biosynthesis: PWY-6936
    • 4 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-12729&oldid=15212"