Difference between revisions of "TRNA-uridines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8618 CPD-8618] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C([CH]=O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridines tRNA-uridines] == * common name: ** a uridine in tRNA * Synonym(s): ** a tRNA con...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8618 CPD-8618] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridines tRNA-uridines] ==
* smiles:
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C([CH]=O)C(O)CC3)))CC4)))C
+
* inchi key:
+
** InChIKey=MHYWFGFPMGLYBL-NUESBDPTSA-N
+
 
* common name:
 
* common name:
** 4α-formyl-5α-cholesta-8-en-3β-ol
+
** a uridine in tRNA
* molecular weight:
+
** 414.67   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a tRNA containing uridine
 +
** a tRNA uridine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-22]]
+
* [[RXN0-1281]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-21]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a uridine in tRNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263320 44263320]
+
{{#set: common name=a tRNA containing uridine|a tRNA uridine}}
* CHEBI:
+
{{#set: consumed by=RXN0-1281}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87054 87054]
+
* HMDB : HMDB12169
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C([CH]=O)C(O)CC3)))CC4)))C}}
+
{{#set: inchi key=InChIKey=MHYWFGFPMGLYBL-NUESBDPTSA-N}}
+
{{#set: common name=4α-formyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: molecular weight=414.67    }}
+
{{#set: consumed by=RXN66-22}}
+
{{#set: produced by=RXN66-21}}
+

Latest revision as of 15:46, 23 May 2018

Metabolite tRNA-uridines

  • common name:
    • a uridine in tRNA
  • Synonym(s):
    • a tRNA containing uridine
    • a tRNA uridine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links