Difference between revisions of "CHC T00009215001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12449 CPD-12449] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C=CC(O)=CC=1))COP(=O)...")
(Created page with "Category:Gene == Gene CHC_T00009215001 == * left end position: ** 196367 * transcription direction: ** POSITIVE * right end position: ** 197632 * centisome position: ** 46...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12449 CPD-12449] ==
+
== Gene CHC_T00009215001 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** 196367
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KGYNXBHEANIYOS-FUEUKBNZSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4-dihydrocoumaroyl-CoA
+
** 197632
−
* molecular weight:
+
* centisome position:
−
** 911.663    
+
** 46.753155    
 
* Synonym(s):
 
* Synonym(s):
−
** 4-hydroxydihydrocinnamoyl-CoA
 
−
** p-dihydrocoumaroyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11468]]
+
* Reaction: [[GLUTRNAREDUCT-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-5188]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=196367}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657717 90657717]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: right end position=197632}}
−
{{#set: inchi key=InChIKey=KGYNXBHEANIYOS-FUEUKBNZSA-J}}
+
{{#set: centisome position=46.753155   }}
−
{{#set: common name=4-dihydrocoumaroyl-CoA}}
+
{{#set: reaction associated=GLUTRNAREDUCT-RXN}}
−
{{#set: molecular weight=911.663   }}
+
{{#set: pathway associated=PWY-5188}}
−
{{#set: common name=4-hydroxydihydrocinnamoyl-CoA|p-dihydrocoumaroyl-CoA}}
+
−
{{#set: consumed by=RXN-11468}}
+

Latest revision as of 15:47, 23 May 2018

Gene CHC_T00009215001

  • left end position:
    • 196367
  • transcription direction:
    • POSITIVE
  • right end position:
    • 197632
  • centisome position:
    • 46.753155
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00009215001&oldid=15327"