Difference between revisions of "CPD-12449"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009439001 == * left end position: ** 44909 * transcription direction: ** POSITIVE * right end position: ** 46828 * centisome position: ** 86.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12449 CPD-12449] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C=CC(O)=CC=1))COP(=O)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12449 CPD-12449] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=KGYNXBHEANIYOS-FUEUKBNZSA-J |
| − | * | + | * common name: |
| − | ** | + | ** 4-dihydrocoumaroyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 911.663 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 4-hydroxydihydrocinnamoyl-CoA | ||
| + | ** p-dihydrocoumaroyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-11468]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657717 90657717] |
| − | {{#set: | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=KGYNXBHEANIYOS-FUEUKBNZSA-J}} |
| − | {{#set: | + | {{#set: common name=4-dihydrocoumaroyl-CoA}} |
| + | {{#set: molecular weight=911.663 }} | ||
| + | {{#set: common name=4-hydroxydihydrocinnamoyl-CoA|p-dihydrocoumaroyl-CoA}} | ||
| + | {{#set: consumed by=RXN-11468}} | ||
Revision as of 16:49, 23 May 2018
Contents
Metabolite CPD-12449
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- inchi key:
- InChIKey=KGYNXBHEANIYOS-FUEUKBNZSA-J
- common name:
- 4-dihydrocoumaroyl-CoA
- molecular weight:
- 911.663
- Synonym(s):
- 4-hydroxydihydrocinnamoyl-CoA
- p-dihydrocoumaroyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.
