Difference between revisions of "CPD-19151"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCDPKIN-RXN DCDPKIN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** nucleoside-diphosphate...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] == * smiles: ** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCDPKIN-RXN DCDPKIN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J
 
* common name:
 
* common name:
** nucleoside-diphosphate kinase
+
** (S)-3-hydroxy-(5Z)-dodecenoyl-CoA
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/2.7.4.6 EC-2.7.4.6]
+
** 959.791   
 
* Synonym(s):
 
* Synonym(s):
 +
** (S)-3-hydroxy-12:1-Δ5-CoA
 +
** (S)-3-hydroxy-5-cis-dodecenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-17798]]
** 1 [[DCDP]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[DCTP]][c] '''+''' 1 [[ADP]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-17797]]
** 1 dCDP[c] '''+''' 1 ATP[c] '''=>''' 1 dCTP[c] '''+''' 1 ADP[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00009258001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[CHC_T00009233001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[CHC_T00009258001_1]]
+
** [[pantograph]]-[[a.taliana]]
+
* [[CHC_T00009233001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
* [[PWY-7210]], pyrimidine deoxyribonucleotides biosynthesis from CTP: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7210 PWY-7210]
+
** '''8''' reactions found over '''8''' reactions in the full pathway
+
* [[PWY-7198]], pyrimidine deoxyribonucleotides de novo biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7198 PWY-7198]
+
** '''6''' reactions found over '''7''' reactions in the full pathway
+
* [[PWY-7184]], pyrimidine deoxyribonucleotides de novo biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7184 PWY-7184]
+
** '''9''' reactions found over '''9''' reactions in the full pathway
+
* [[PWY-7197]], pyrimidine deoxyribonucleotide phosphorylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7197 PWY-7197]
+
** '''4''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY0-166]], superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-166 PWY0-166]
+
** '''12''' reactions found over '''17''' reactions in the full pathway
+
* [[PWY-6545]], pyrimidine deoxyribonucleotides de novo biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6545 PWY-6545]
+
** '''8''' reactions found over '''9''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
*** [[a.taliana]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
{{#set: smiles=CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27678 27678]
+
{{#set: inchi key=InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J}}
* LIGAND-RXN:
+
{{#set: common name=(S)-3-hydroxy-(5Z)-dodecenoyl-CoA}}
** [http://www.genome.jp/dbget-bin/www_bget?R02326 R02326]
+
{{#set: molecular weight=959.791    }}
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=(S)-3-hydroxy-12:1-Δ5-CoA|(S)-3-hydroxy-5-cis-dodecenoyl-CoA}}
{{#set: common name=nucleoside-diphosphate kinase}}
+
{{#set: consumed by=RXN-17798}}
{{#set: ec number=EC-2.7.4.6}}
+
{{#set: produced by=RXN-17797}}
{{#set: gene associated=CHC_T00009258001|CHC_T00009233001|CHC_T00009258001_1|CHC_T00009233001_1}}
+
{{#set: in pathway=PWY-7210|PWY-7198|PWY-7184|PWY-7197|PWY0-166|PWY-6545}}
+
{{#set: reconstruction category=orthology}}
+
{{#set: reconstruction tool=pantograph}}
+
{{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reconstruction source=original_genome}}
+

Revision as of 15:50, 23 May 2018

Metabolite CPD-19151

  • smiles:
    • CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J
  • common name:
    • (S)-3-hydroxy-(5Z)-dodecenoyl-CoA
  • molecular weight:
    • 959.791
  • Synonym(s):
    • (S)-3-hydroxy-12:1-Δ5-CoA
    • (S)-3-hydroxy-5-cis-dodecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.