Difference between revisions of "PWY-5744"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == * smiles: ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) * inchi key: ** InChIKey=J...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5744 PWY-5744] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200795 TAX-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5744 PWY-5744] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200795 TAX-200795] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183924 TAX-183924] |
| − | * | + | |
* common name: | * common name: | ||
| − | ** | + | ** glyoxylate assimilation |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''2''' reactions found over '''11''' reactions in the full pathway |
| − | == Reaction(s) | + | * [[ACETYL-COA-CARBOXYLTRANSFER-RXN]] |
| − | * [ | + | ** 8 associated gene(s): |
| − | == | + | *** [[CHC_T00009359001_1]] |
| − | * [[ | + | *** [[CHC_640]] |
| + | *** [[CHC_T00009359001]] | ||
| + | *** [[CHC_T00008359001]] | ||
| + | *** [[CHC_T00009426001_1]] | ||
| + | *** [[CHC_T00008359001_1]] | ||
| + | *** [[CHC_T00007145001_1]] | ||
| + | *** [[CHC_55]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | * [[RXN-6383]] | ||
| + | ** 3 associated gene(s): | ||
| + | *** [[CHC_T00009110001_1]] | ||
| + | *** [[CHC_T00008882001_1]] | ||
| + | *** [[CHC_T00009349001_1]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=CITRAMALYL-COA-LYASE-RXN CITRAMALYL-COA-LYASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13230 RXN-13230] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8960 RXN-8960] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8961 RXN-8961] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8963 RXN-8963] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8965 RXN-8965] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8974 RXN-8974] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9086 RXN-9086] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9087 RXN-9087] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-200795}} | |
| − | + | {{#set: taxonomic range=TAX-183924}} | |
| − | + | {{#set: common name=glyoxylate assimilation}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=11}} | |
| − | + | {{#set: completion rate=18.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 15:52, 23 May 2018
Pathway PWY-5744
- taxonomic range:
- common name:
- glyoxylate assimilation
- Synonym(s):
Reaction(s) found
2 reactions found over 11 reactions in the full pathway
- ACETYL-COA-CARBOXYLTRANSFER-RXN
- 8 associated gene(s):
- 4 reconstruction source(s) associated:
- RXN-6383
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
