Difference between revisions of "3.5.1.87-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * smiles: ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.5.1.87-RXN 3.5.1.87-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.5.1.87-RXN 3.5.1.87-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.5.1.87 EC-3.5.1.87] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[WATER]][c] '''+''' 1 [[N-Carbamoyl-L-Amino-Acids]][c] '''+''' 2 [[PROTON]][c] '''<=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[L-Amino-Acids]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H2O[c] '''+''' 1 an N-carbamoyl-L-amino acid[c] '''+''' 2 H+[c] '''<=>''' 1 CO2[c] '''+''' 1 ammonium[c] '''+''' 1 an L-amino acid[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00000417001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05782 R05782] |
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: ec number=EC-3.5.1.87}} | |
− | + | {{#set: gene associated=CHC_T00000417001_1}} | |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + |
Latest revision as of 16:54, 23 May 2018
Contents
Reaction 3.5.1.87-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 N-Carbamoyl-L-Amino-Acids[c] + 2 PROTON[c] <=> 1 CARBON-DIOXIDE[c] + 1 AMMONIUM[c] + 1 L-Amino-Acids[c]
- With common name(s):
- 1 H2O[c] + 1 an N-carbamoyl-L-amino acid[c] + 2 H+[c] <=> 1 CO2[c] + 1 ammonium[c] + 1 an L-amino acid[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00000417001_1
- Source: orthology-galdieria.sulphuraria
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
External links
- LIGAND-RXN: