Difference between revisions of "CPD0-2015"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008915001 == * left end position: ** 105689 * transcription direction: ** NEGATIVE * right end position: ** 110428 * centisome position: ** 9....") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] == * smiles: ** CC(=O)NC(CCSC)C([O-])=O * inchi key: ** InChIKey=XUYPXLNMD...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=O)NC(CCSC)C([O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M |
| − | * | + | * common name: |
| − | ** | + | ** Nα-acetyl-L-methionine |
| − | * | + | * molecular weight: |
| − | ** | + | ** 190.237 |
* Synonym(s): | * Synonym(s): | ||
| + | ** N-acetyl-L-methionine | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN0-6948]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * DRUGBANK : DB01646 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6991985 6991985] |
| − | {{#set: | + | * HMDB : HMDB11745 |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02712 C02712] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.395338.html 395338] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71670 71670] | ||
| + | {{#set: smiles=CC(=O)NC(CCSC)C([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M}} | ||
| + | {{#set: common name=Nα-acetyl-L-methionine}} | ||
| + | {{#set: molecular weight=190.237 }} | ||
| + | {{#set: common name=N-acetyl-L-methionine}} | ||
| + | {{#set: produced by=RXN0-6948}} | ||
Revision as of 15:55, 23 May 2018
Contents
Metabolite CPD0-2015
- smiles:
- CC(=O)NC(CCSC)C([O-])=O
- inchi key:
- InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M
- common name:
- Nα-acetyl-L-methionine
- molecular weight:
- 190.237
- Synonym(s):
- N-acetyl-L-methionine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- DRUGBANK : DB01646
- PUBCHEM:
- HMDB : HMDB11745
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
"CC(=O)NC(CCSC)C([O-])=O" cannot be used as a page name in this wiki.
